C18H16F3NO2 — CID 3562949
3-(2-ethoxyphenyl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 3562949) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | 3-(2-ethoxyphenyl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3562949 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-(2-ethoxyphenyl)-N-[2-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCOc1ccccc1C=CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO2/c1-2-24-16-10-6-3-7-13(16)11-12-17(23)22-15-9-5-4-8-14(15)18(19,20)21/h3-12H,2H2,1H3,(H,22,23) |
| InChIKey | OTSGZMWCENMDRZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|