C19H20ClNO4 — CID 5226614
N-(4-chloro-2,5-dimethoxyphenyl)-3-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 5226614) has the molecular formula C19H20ClNO4 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5226614 |
| Molecular Formula | C19H20ClNO4 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccccc1C=CC(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C19H20ClNO4/c1-4-25-16-8-6-5-7-13(16)9-10-19(22)21-15-12-17(23-2)14(20)11-18(15)24-3/h5-12H,4H2,1-3H3,(H,21,22) |
| InChIKey | LXXRUFAQPVGDHG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|