C17H15F2NO2 — CID 9165751
(E)-N-(3,4-difluorophenyl)-3-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 9165751) has the molecular formula C17H15F2NO2 and a molecular weight of 303.31 g/mol. Its IUPAC name is (E)-N-(3,4-difluorophenyl)-3-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3,4-difluorophenyl)-3-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9165751 |
| Molecular Formula | C17H15F2NO2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (E)-N-(3,4-difluorophenyl)-3-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccccc1/C=C/C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H15F2NO2/c1-2-22-16-6-4-3-5-12(16)7-10-17(21)20-13-8-9-14(18)15(19)11-13/h3-11H,2H2,1H3,(H,20,21)/b10-7+ |
| InChIKey | CCTLPDKZXHDSES-JXMROGBWSA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|