C20H18ClF3N2O4 — CID 108514543
butyl 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoacetyl]amino]benzoate (PubChem CID 108514543) has the molecular formula C20H18ClF3N2O4 and a molecular weight of 442.82 g/mol. Its IUPAC name is butyl 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoacetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108514543 |
| Molecular Formula | C20H18ClF3N2O4 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | butyl 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18ClF3N2O4/c1-2-3-10-30-19(29)13-6-4-5-7-16(13)26-18(28)17(27)25-12-8-9-15(21)14(11-12)20(22,23)24/h4-9,11H,2-3,10H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | URTUSNLPLOCHCZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|