C17H14ClF3N2O3 — CID 9101546
methyl 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]acetyl]amino]benzoate (PubChem CID 9101546) has the molecular formula C17H14ClF3N2O3 and a molecular weight of 386.76 g/mol. Its IUPAC name is methyl 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9101546 |
| Molecular Formula | C17H14ClF3N2O3 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | methyl 2-[[2-[4-chloro-3-(trifluoromethyl)anilino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CNc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14ClF3N2O3/c1-26-16(25)11-4-2-3-5-14(11)23-15(24)9-22-10-6-7-13(18)12(8-10)17(19,20)21/h2-8,22H,9H2,1H3,(H,23,24) |
| InChIKey | INWMUUQMSADMFV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |