C16H14ClFN2O3 — CID 37230186
methyl 2-chloro-5-[[2-(2-fluoroanilino)-2-oxoethyl]amino]benzoate (PubChem CID 37230186) has the molecular formula C16H14ClFN2O3 and a molecular weight of 336.75 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-(2-fluoroanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-(2-fluoroanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 37230186 |
| Molecular Formula | C16H14ClFN2O3 |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | methyl 2-chloro-5-[[2-(2-fluoroanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NCC(=O)Nc2ccccc2F)ccc1Cl |
| InChI | InChI=1S/C16H14ClFN2O3/c1-23-16(22)11-8-10(6-7-12(11)17)19-9-15(21)20-14-5-3-2-4-13(14)18/h2-8,19H,9H2,1H3,(H,20,21) |
| InChIKey | LTWYIQCGKUHQPG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |