C16H14F2N2O3 — CID 37471968
methyl 2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzoate (PubChem CID 37471968) has the molecular formula C16H14F2N2O3 and a molecular weight of 320.30 g/mol. Its IUPAC name is methyl 2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 37471968 |
| Molecular Formula | C16H14F2N2O3 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl 2-[[2-(3,4-difluoroanilino)-2-oxoethyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H14F2N2O3/c1-23-16(22)11-4-2-3-5-14(11)19-9-15(21)20-10-6-7-12(17)13(18)8-10/h2-8,19H,9H2,1H3,(H,20,21) |
| InChIKey | JLCXRYBYFDMESR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |