C17H16F2N2O4 — CID 40955708
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 40955708) has the molecular formula C17H16F2N2O4 and a molecular weight of 350.32 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 40955708 |
| Molecular Formula | C17H16F2N2O4 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NCCO)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H16F2N2O4/c18-13-6-5-11(9-14(13)19)21-16(23)10-25-17(24)12-3-1-2-4-15(12)20-7-8-22/h1-6,9,20,22H,7-8,10H2,(H,21,23) |
| InChIKey | PRRHNIFGCIFDCR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |