C22H17F2NO3 — CID 2335239
[2-(3,4-difluoroanilino)-2-oxoethyl] 2-(4-methylphenyl)benzoate (PubChem CID 2335239) has the molecular formula C22H17F2NO3 and a molecular weight of 381.38 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(4-methylphenyl)benzoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(4-methylphenyl)benzoate |
|---|---|
| PubChem CID | 2335239 |
| Molecular Formula | C22H17F2NO3 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 2-(4-methylphenyl)benzoate |
| SMILES | Cc1ccc(-c2ccccc2C(=O)OCC(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C22H17F2NO3/c1-14-6-8-15(9-7-14)17-4-2-3-5-18(17)22(27)28-13-21(26)25-16-10-11-19(23)20(24)12-16/h2-12H,13H2,1H3,(H,25,26) |
| InChIKey | KHEOWWKJHSWZOM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |