C24H23NO3 — CID 7554635
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] 2-phenylbenzoate (PubChem CID 7554635) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 2-phenylbenzoate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7554635 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 2-phenylbenzoate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)c2ccccc2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H23NO3/c1-16-13-17(2)23(18(3)14-16)25-22(26)15-28-24(27)21-12-8-7-11-20(21)19-9-5-4-6-10-19/h4-14H,15H2,1-3H3,(H,25,26) |
| InChIKey | IHTNMQSCKZIBAY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |