About [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate
[2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7554634) has the molecular formula C22H19NO4
and a molecular weight of 361.40 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate.
Molecular Properties
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate |
| PubChem CID | 7554634 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate |
| SMILES | COc1ccccc1NC(=O)COC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H19NO4/c1-26-20-14-8-7-13-19(20)23-21(24)15-27-22(25)18-12-6-5-11-17(18)16-9-3-2-4-10-16/h2-14H,15H2,1H3,(H,23,24) |
| InChIKey | PLMPOGRHVGOMQM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate?
The IUPAC name of [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate (CID 7554634) is [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate.
What is the SMILES notation for [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate?
The canonical SMILES for [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate is COc1ccccc1NC(=O)COC(=O)c1ccccc1-c1ccccc1.
What is the InChIKey of [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate?
The InChIKey is PLMPOGRHVGOMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO4/c1-26-20-14-8-7-13-19(20)23-21(24)15-27-22(25)18-12-6-5-11-17(18)16-9-3-2-4-10-16/h2-14H,15H2,1H3,(H,23,24).
What are the key properties of [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate?
[2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate has a molecular weight of 361.40 g/mol, XLogP of 4.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methoxyanilino)-2-oxoethyl] 2-phenylbenzoate is sourced from PubChem (CID 7554634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).