C21H15F2NO3 — CID 7229200
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7229200) has the molecular formula C21H15F2NO3 and a molecular weight of 367.35 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylbenzoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7229200 |
| Molecular Formula | C21H15F2NO3 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1-c1ccccc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C21H15F2NO3/c22-15-10-11-19(18(23)12-15)24-20(25)13-27-21(26)17-9-5-4-8-16(17)14-6-2-1-3-7-14/h1-12H,13H2,(H,24,25) |
| InChIKey | BLSCEZXVKZUXBO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |