C23H19F2NO6S — CID 35988585
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 35988585) has the molecular formula C23H19F2NO6S and a molecular weight of 475.47 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 35988585 |
| Molecular Formula | C23H19F2NO6S |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccccc2C(=O)OCC(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C23H19F2NO6S/c1-14-7-8-15(2)21(11-14)33(29,30)32-20-6-4-3-5-17(20)23(28)31-13-22(27)26-19-10-9-16(24)12-18(19)25/h3-12H,13H2,1-2H3,(H,26,27) |
| InChIKey | JMHKLDJGGLFFGB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|