C22H18ClFO5S — CID 2535245
(2-chloro-6-fluorophenyl)methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 2535245) has the molecular formula C22H18ClFO5S and a molecular weight of 448.90 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 2535245 |
| Molecular Formula | C22H18ClFO5S |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccccc2C(=O)OCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C22H18ClFO5S/c1-14-10-11-15(2)21(12-14)30(26,27)29-20-9-4-3-6-16(20)22(25)28-13-17-18(23)7-5-8-19(17)24/h3-12H,13H2,1-2H3 |
| InChIKey | SGKQJPAJGPSRGZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|