C18H18O6S — CID 2535232
2-oxopropyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 2535232) has the molecular formula C18H18O6S and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-oxopropyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | 2-oxopropyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 2535232 |
| Molecular Formula | C18H18O6S |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-oxopropyl 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | CC(=O)COC(=O)c1ccccc1OS(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C18H18O6S/c1-12-8-9-13(2)17(10-12)25(21,22)24-16-7-5-4-6-15(16)18(20)23-11-14(3)19/h4-10H,11H2,1-3H3 |
| InChIKey | CWAIBIWKDUAUAK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|