C26H21N3O6S — CID 137300438
[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 137300438) has the molecular formula C26H21N3O6S and a molecular weight of 503.54 g/mol. Its IUPAC name is [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 137300438 |
| Molecular Formula | C26H21N3O6S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccccc2C(=O)OC/C(O)=C(/C#N)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C26H21N3O6S/c1-16-11-12-17(2)24(13-16)36(32,33)35-23-10-6-3-7-18(23)26(31)34-15-22(30)19(14-27)25-28-20-8-4-5-9-21(20)29-25/h3-13,30H,15H2,1-2H3,(H,28,29)/b22-19+ |
| InChIKey | LTEALRIYOQWWKZ-ZBJSNUHESA-N |
| XLogP | 4.60 |
| TPSA | 142.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|