C17H13N3O3S — CID 135466317
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-methylthiophene-2-carboxylate (PubChem CID 135466317) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-methylthiophene-2-carboxylate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 135466317 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-methylthiophene-2-carboxylate |
| SMILES | Cc1ccc(C(=O)OC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C17H13N3O3S/c1-10-6-7-15(24-10)17(22)23-9-14(21)11(8-18)16-19-12-4-2-3-5-13(12)20-16/h2-7,21H,9H2,1H3,(H,19,20)/b14-11- |
| InChIKey | LYGICMCBWQGIIQ-KAMYIIQDSA-N |
| XLogP | 3.58 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|