C19H17N3O4 — CID 135599191
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,4,5-trimethylfuran-3-carboxylate (PubChem CID 135599191) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,4,5-trimethylfuran-3-carboxylate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,4,5-trimethylfuran-3-carboxylate |
|---|---|
| PubChem CID | 135599191 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2,4,5-trimethylfuran-3-carboxylate |
| SMILES | Cc1oc(C)c(C(=O)OC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)c1C |
| InChI | InChI=1S/C19H17N3O4/c1-10-11(2)26-12(3)17(10)19(24)25-9-16(23)13(8-20)18-21-14-6-4-5-7-15(14)22-18/h4-7,23H,9H2,1-3H3,(H,21,22)/b16-13- |
| InChIKey | XVRPDOCWYYASFQ-SSZFMOIBSA-N |
| XLogP | 3.73 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|