C22H16N4O4 — CID 136704863
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 136704863) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 136704863 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)OCC(O)=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H16N4O4/c1-13-19(26-21(30-13)14-7-3-2-4-8-14)22(28)29-12-18(27)15(11-23)20-24-16-9-5-6-10-17(16)25-20/h2-10,27H,12H2,1H3,(H,24,25) |
| InChIKey | ULLOVJKFYRZAIS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|