C21H19N3O6 — CID 3948705
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3,4,5-trimethoxybenzoate (PubChem CID 3948705) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3948705 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(O)=C(C#N)c2nc3ccccc3[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C21H19N3O6/c1-27-17-8-12(9-18(28-2)19(17)29-3)21(26)30-11-16(25)13(10-22)20-23-14-6-4-5-7-15(14)24-20/h4-9,25H,11H2,1-3H3,(H,23,24) |
| InChIKey | ILMRIULMAYEOCQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|