C22H20BrN3O5 — CID 135538543
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-bromo-5-methoxy-4-propoxybenzoate (PubChem CID 135538543) has the molecular formula C22H20BrN3O5 and a molecular weight of 486.32 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-bromo-5-methoxy-4-propoxybenzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-bromo-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 135538543 |
| Molecular Formula | C22H20BrN3O5 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-bromo-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Br)cc(C(=O)OC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)cc1OC |
| InChI | InChI=1S/C22H20BrN3O5/c1-3-8-30-20-15(23)9-13(10-19(20)29-2)22(28)31-12-18(27)14(11-24)21-25-16-6-4-5-7-17(16)26-21/h4-7,9-10,27H,3,8,12H2,1-2H3,(H,25,26)/b18-14- |
| InChIKey | ZIGPBSLJKMVUNI-JXAWBTAJSA-N |
| XLogP | 4.77 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|