C20H14N4O7 — CID 4019188
3-O-[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 4019188) has the molecular formula C20H14N4O7 and a molecular weight of 422.35 g/mol. Its IUPAC name is 3-O-[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4019188 |
| Molecular Formula | C20H14N4O7 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 3-O-[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCC(O)=C(C#N)c2nc3ccccc3[nH]2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14N4O7/c1-30-19(26)11-6-12(8-13(7-11)24(28)29)20(27)31-10-17(25)14(9-21)18-22-15-4-2-3-5-16(15)23-18/h2-8,25H,10H2,1H3,(H,22,23) |
| InChIKey | IPBSNXRFPLMWIC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|