C22H19N5O5 — CID 135840317
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-nitro-2-pyrrolidin-1-ylbenzoate (PubChem CID 135840317) has the molecular formula C22H19N5O5 and a molecular weight of 433.42 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-nitro-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 135840317 |
| Molecular Formula | C22H19N5O5 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-nitro-2-pyrrolidin-1-ylbenzoate |
| SMILES | N#C/C(=C(/O)COC(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H19N5O5/c23-12-16(21-24-17-5-1-2-6-18(17)25-21)20(28)13-32-22(29)15-11-14(27(30)31)7-8-19(15)26-9-3-4-10-26/h1-2,5-8,11,28H,3-4,9-10,13H2,(H,24,25)/b20-16- |
| InChIKey | VEFCCXJREFFEES-SILNSSARSA-N |
| XLogP | 3.72 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|