C18H11BrClN3O3 — CID 137266451
[(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-bromo-2-chlorobenzoate (PubChem CID 137266451) has the molecular formula C18H11BrClN3O3 and a molecular weight of 432.66 g/mol. Its IUPAC name is [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 137266451 |
| Molecular Formula | C18H11BrClN3O3 |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | [(E)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 5-bromo-2-chlorobenzoate |
| SMILES | N#C/C(=C(\O)COC(=O)c1cc(Br)ccc1Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H11BrClN3O3/c19-10-5-6-13(20)11(7-10)18(25)26-9-16(24)12(8-21)17-22-14-3-1-2-4-15(14)23-17/h1-7,24H,9H2,(H,22,23)/b16-12+ |
| InChIKey | CKXYEPLJTDYPRD-FOWTUZBSSA-N |
| XLogP | 4.63 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|