C22H21ClN4O5S — CID 4282209
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-chloro-5-(diethylsulfamoyl)benzoate (PubChem CID 4282209) has the molecular formula C22H21ClN4O5S and a molecular weight of 488.95 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-chloro-5-(diethylsulfamoyl)benzoate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 4282209 |
| Molecular Formula | C22H21ClN4O5S |
| Molecular Weight | 488.95 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-chloro-5-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(O)=C(C#N)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C22H21ClN4O5S/c1-3-27(4-2)33(30,31)14-9-10-17(23)15(11-14)22(29)32-13-20(28)16(12-24)21-25-18-7-5-6-8-19(18)26-21/h5-11,28H,3-4,13H2,1-2H3,(H,25,26) |
| InChIKey | ZVSPDGAZMYEOJS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.95 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|