C23H22N4O6S — CID 135757390
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 135757390) has the molecular formula C23H22N4O6S and a molecular weight of 482.52 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 135757390 |
| Molecular Formula | C23H22N4O6S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)OC/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H22N4O6S/c1-15-6-7-16(34(30,31)27-8-10-32-11-9-27)12-17(15)23(29)33-14-21(28)18(13-24)22-25-19-4-2-3-5-20(19)26-22/h2-7,12,28H,8-11,14H2,1H3,(H,25,26)/b21-18- |
| InChIKey | HLYWUKXJARASEE-UZYVYHOESA-N |
| XLogP | 2.54 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|