C22H20N4O5S — CID 135788617
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 135788617) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 135788617 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | N#C/C(=C(/O)COC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H20N4O5S/c23-13-17(21-24-18-5-1-2-6-19(18)25-21)20(27)14-31-22(28)15-7-9-16(10-8-15)32(29,30)26-11-3-4-12-26/h1-2,5-10,27H,3-4,11-12,14H2,(H,24,25)/b20-17- |
| InChIKey | WQAXRAGUKSCDGL-JZJYNLBNSA-N |
| XLogP | 3.00 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|