C21H20N4O3S — CID 135458298
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-3-(4-piperidin-1-ylsulfonylphenyl)prop-2-enenitrile (PubChem CID 135458298) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-3-(4-piperidin-1-ylsulfonylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-3-(4-piperidin-1-ylsulfonylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135458298 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-3-(4-piperidin-1-ylsulfonylphenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1ccc(S(=O)(=O)N2CCCCC2)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H20N4O3S/c22-14-17(21-23-18-6-2-3-7-19(18)24-21)20(26)15-8-10-16(11-9-15)29(27,28)25-12-4-1-5-13-25/h2-3,6-11,26H,1,4-5,12-13H2,(H,23,24)/b20-17- |
| InChIKey | QZMFREPOXZHJRX-JZJYNLBNSA-N |
| XLogP | 3.69 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|