C16H10IN3O — CID 5091860
2-(1H-benzimidazol-2-yl)-3-hydroxy-3-(4-iodophenyl)prop-2-enenitrile (PubChem CID 5091860) has the molecular formula C16H10IN3O and a molecular weight of 387.18 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-hydroxy-3-(4-iodophenyl)prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-3-(4-iodophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5091860 |
| Molecular Formula | C16H10IN3O |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-3-(4-iodophenyl)prop-2-enenitrile |
| SMILES | N#CC(=C(O)c1ccc(I)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H10IN3O/c17-11-7-5-10(6-8-11)15(21)12(9-18)16-19-13-3-1-2-4-14(13)20-16/h1-8,21H,(H,19,20) |
| InChIKey | FBEUJVWGNXJJEJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|