C16H11KN4S — CID 10871244
potassium (E)-1-anilino-2-(1H-benzimidazol-2-yl)-2-cyanoethenethiolate (PubChem CID 10871244) has the molecular formula C16H11KN4S and a molecular weight of 330.46 g/mol. Its IUPAC name is potassium (E)-1-anilino-2-(1H-benzimidazol-2-yl)-2-cyanoethenethiolate.
| Compound Name | potassium (E)-1-anilino-2-(1H-benzimidazol-2-yl)-2-cyanoethenethiolate |
|---|---|
| PubChem CID | 10871244 |
| Molecular Formula | C16H11KN4S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | potassium (E)-1-anilino-2-(1H-benzimidazol-2-yl)-2-cyanoethenethiolate |
| SMILES | N#C/C(=C(\[S-])Nc1ccccc1)c1nc2ccccc2[nH]1.[K+] |
| InChI | InChI=1S/C16H12N4S.K/c17-10-12(16(21)18-11-6-2-1-3-7-11)15-19-13-8-4-5-9-14(13)20-15;/h1-9,18,21H,(H,19,20);/q;+1/p-1/b16-12+; |
| InChIKey | RRLQUDUZKWRYCZ-CLNHMMGSSA-M |
| XLogP | 0.42 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|