C17H21N4O+ — CID 135830761
(Z)-4-(azepan-1-ium-1-yl)-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile (PubChem CID 135830761) has the molecular formula C17H21N4O+ and a molecular weight of 297.38 g/mol. Its IUPAC name is (Z)-4-(azepan-1-ium-1-yl)-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile.
| Compound Name | (Z)-4-(azepan-1-ium-1-yl)-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 135830761 |
| Molecular Formula | C17H21N4O+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (Z)-4-(azepan-1-ium-1-yl)-2-(1H-benzimidazol-2-yl)-3-hydroxybut-2-enenitrile |
| SMILES | N#C/C(=C(/O)C[NH+]1CCCCCC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H20N4O/c18-11-13(16(22)12-21-9-5-1-2-6-10-21)17-19-14-7-3-4-8-15(14)20-17/h3-4,7-8,22H,1-2,5-6,9-10,12H2,(H,19,20)/p+1/b16-13- |
| InChIKey | AGFFULFLQOZMHY-SSZFMOIBSA-O |
| XLogP | 1.81 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|