C17H19N4O2+ — CID 135538977
3-hydroxy-2-(4-oxo-3H-quinazolin-2-yl)-4-piperidin-1-ium-1-ylbut-2-enenitrile (PubChem CID 135538977) has the molecular formula C17H19N4O2+ and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-hydroxy-2-(4-oxo-3H-quinazolin-2-yl)-4-piperidin-1-ium-1-ylbut-2-enenitrile.
| Compound Name | 3-hydroxy-2-(4-oxo-3H-quinazolin-2-yl)-4-piperidin-1-ium-1-ylbut-2-enenitrile |
|---|---|
| PubChem CID | 135538977 |
| Molecular Formula | C17H19N4O2+ |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-hydroxy-2-(4-oxo-3H-quinazolin-2-yl)-4-piperidin-1-ium-1-ylbut-2-enenitrile |
| SMILES | N#CC(=C(O)C[NH+]1CCCCC1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H18N4O2/c18-10-13(15(22)11-21-8-4-1-5-9-21)16-19-14-7-3-2-6-12(14)17(23)20-16/h2-3,6-7,22H,1,4-5,8-9,11H2,(H,19,20,23)/p+1 |
| InChIKey | JFDULZPOFFVVPU-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|