C12H7BrClN3O2 — CID 154039189
2-(7-bromo-4-oxo-3H-quinazolin-2-yl)-4-chloro-3-hydroxybut-2-enenitrile (PubChem CID 154039189) has the molecular formula C12H7BrClN3O2 and a molecular weight of 340.56 g/mol. Its IUPAC name is 2-(7-bromo-4-oxo-3H-quinazolin-2-yl)-4-chloro-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(7-bromo-4-oxo-3H-quinazolin-2-yl)-4-chloro-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 154039189 |
| Molecular Formula | C12H7BrClN3O2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 338.94 |
| IUPAC Name | 2-(7-bromo-4-oxo-3H-quinazolin-2-yl)-4-chloro-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)CCl)c1nc2cc(Br)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C12H7BrClN3O2/c13-6-1-2-7-9(3-6)16-11(17-12(7)19)8(5-15)10(18)4-14/h1-3,18H,4H2,(H,16,17,19) |
| InChIKey | JNHUFSSLUSCFAC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|