C11H12BrN3O — CID 136705321
7-bromo-2-[2-(methylamino)ethyl]-3H-quinazolin-4-one (PubChem CID 136705321) has the molecular formula C11H12BrN3O and a molecular weight of 282.14 g/mol. Its IUPAC name is 7-bromo-2-[2-(methylamino)ethyl]-3H-quinazolin-4-one.
| Compound Name | 7-bromo-2-[2-(methylamino)ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136705321 |
| Molecular Formula | C11H12BrN3O |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 7-bromo-2-[2-(methylamino)ethyl]-3H-quinazolin-4-one |
| SMILES | CNCCc1nc2cc(Br)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H12BrN3O/c1-13-5-4-10-14-9-6-7(12)2-3-8(9)11(16)15-10/h2-3,6,13H,4-5H2,1H3,(H,14,15,16) |
| InChIKey | NIWIYVGRBDCCTP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |