C10H13Cl2N3 — CID 53398953
2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;hydrochloride (PubChem CID 53398953) has the molecular formula C10H13Cl2N3 and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;hydrochloride.
| Compound Name | 2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 53398953 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine;hydrochloride |
| SMILES | CNCCc1nc2ccc(Cl)cc2[nH]1.Cl |
| InChI | InChI=1S/C10H12ClN3.ClH/c1-12-5-4-10-13-8-3-2-7(11)6-9(8)14-10;/h2-3,6,12H,4-5H2,1H3,(H,13,14);1H |
| InChIKey | UHAGJUCMNKKLOE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |