C11H16ClN3O — CID 72942363
2-(6-methoxy-1H-benzimidazol-2-yl)-N-methylethanamine;hydrochloride (PubChem CID 72942363) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-(6-methoxy-1H-benzimidazol-2-yl)-N-methylethanamine;hydrochloride.
| Compound Name | 2-(6-methoxy-1H-benzimidazol-2-yl)-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 72942363 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-(6-methoxy-1H-benzimidazol-2-yl)-N-methylethanamine;hydrochloride |
| SMILES | CNCCc1nc2ccc(OC)cc2[nH]1.Cl |
| InChI | InChI=1S/C11H15N3O.ClH/c1-12-6-5-11-13-9-4-3-8(15-2)7-10(9)14-11;/h3-4,7,12H,5-6H2,1-2H3,(H,13,14);1H |
| InChIKey | JWGXKBKQIYVETN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |