C20H27ClN4O3 — CID 161003256
2-(chloromethyl)-6-methoxy-1H-benzimidazole;methane;(6-methoxy-1H-benzimidazol-2-yl)methanol (PubChem CID 161003256) has the molecular formula C20H27ClN4O3 and a molecular weight of 406.91 g/mol. Its IUPAC name is 2-(chloromethyl)-6-methoxy-1H-benzimidazole;methane;(6-methoxy-1H-benzimidazol-2-yl)methanol.
| Compound Name | 2-(chloromethyl)-6-methoxy-1H-benzimidazole;methane;(6-methoxy-1H-benzimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 161003256 |
| Molecular Formula | C20H27ClN4O3 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-(chloromethyl)-6-methoxy-1H-benzimidazole;methane;(6-methoxy-1H-benzimidazol-2-yl)methanol |
| SMILES | C.C.COc1ccc2nc(CCl)[nH]c2c1.COc1ccc2nc(CO)[nH]c2c1 |
| InChI | InChI=1S/C9H9ClN2O.C9H10N2O2.2CH4/c1-13-6-2-3-7-8(4-6)12-9(5-10)11-7;1-13-6-2-3-7-8(4-6)11-9(5-12)10-7;;/h2-4H,5H2,1H3,(H,11,12);2-4,12H,5H2,1H3,(H,10,11);2*1H4 |
| InChIKey | TWDZQOMRRKLYPU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|