C10H12Cl2N2O2 — CID 75481538
2-(chloromethyl)-5,6-dimethoxy-1H-benzimidazole;hydrochloride (PubChem CID 75481538) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6-dimethoxy-1H-benzimidazole;hydrochloride.
| Compound Name | 2-(chloromethyl)-5,6-dimethoxy-1H-benzimidazole;hydrochloride |
|---|---|
| PubChem CID | 75481538 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2-(chloromethyl)-5,6-dimethoxy-1H-benzimidazole;hydrochloride |
| SMILES | COc1cc2nc(CCl)[nH]c2cc1OC.Cl |
| InChI | InChI=1S/C10H11ClN2O2.ClH/c1-14-8-3-6-7(4-9(8)15-2)13-10(5-11)12-6;/h3-4H,5H2,1-2H3,(H,12,13);1H |
| InChIKey | WKHXKKNTGLVTOA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|