C13H19N3O3 — CID 82336811
2-[2-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethylamino]ethanol (PubChem CID 82336811) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[2-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethylamino]ethanol.
| Compound Name | 2-[2-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 82336811 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-[2-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethylamino]ethanol |
| SMILES | COc1cc2nc(CCNCCO)[nH]c2cc1OC |
| InChI | InChI=1S/C13H19N3O3/c1-18-11-7-9-10(8-12(11)19-2)16-13(15-9)3-4-14-5-6-17/h7-8,14,17H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | OTRXIHQCTNSYKA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|