C18H20N2O2 — CID 39158365
5,6-dimethoxy-2-[2-(4-methylphenyl)ethyl]-1H-benzimidazole (PubChem CID 39158365) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 5,6-dimethoxy-2-[2-(4-methylphenyl)ethyl]-1H-benzimidazole.
| Compound Name | 5,6-dimethoxy-2-[2-(4-methylphenyl)ethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 39158365 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 5,6-dimethoxy-2-[2-(4-methylphenyl)ethyl]-1H-benzimidazole |
| SMILES | COc1cc2nc(CCc3ccc(C)cc3)[nH]c2cc1OC |
| InChI | InChI=1S/C18H20N2O2/c1-12-4-6-13(7-5-12)8-9-18-19-14-10-16(21-2)17(22-3)11-15(14)20-18/h4-7,10-11H,8-9H2,1-3H3,(H,19,20) |
| InChIKey | YLPJGCDILDIXSY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |