C19H23N3 — CID 82336988
2-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(4-methylphenyl)methyl]ethanamine (PubChem CID 82336988) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(4-methylphenyl)methyl]ethanamine.
| Compound Name | 2-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(4-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 82336988 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-[(4-methylphenyl)methyl]ethanamine |
| SMILES | Cc1ccc(CNCCc2nc3cc(C)c(C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H23N3/c1-13-4-6-16(7-5-13)12-20-9-8-19-21-17-10-14(2)15(3)11-18(17)22-19/h4-7,10-11,20H,8-9,12H2,1-3H3,(H,21,22) |
| InChIKey | UHXJHRPVHHUSGH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|