C25H27N3O — CID 66529010
3-(1H-benzimidazol-2-yl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 66529010) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66529010 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | Cc1ccc(COc2ccc(CNCCCc3nc4ccccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O/c1-19-8-10-21(11-9-19)18-29-22-14-12-20(13-15-22)17-26-16-4-7-25-27-23-5-2-3-6-24(23)28-25/h2-3,5-6,8-15,26H,4,7,16-18H2,1H3,(H,27,28) |
| InChIKey | NCQQTFNPTNCSGD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|