C27H31N3O2 — CID 66529028
3-(1H-benzimidazol-2-yl)-N-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 66529028) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66529028 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCOc1cc(CNCCCc2nc3ccccc3[nH]2)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C27H31N3O2/c1-3-31-26-17-22(14-15-25(26)32-19-21-12-10-20(2)11-13-21)18-28-16-6-9-27-29-23-7-4-5-8-24(23)30-27/h4-5,7-8,10-15,17,28H,3,6,9,16,18-19H2,1-2H3,(H,29,30) |
| InChIKey | XFYMRVUHEOKXQK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|