C26H26Cl3N3O2 — CID 66538056
3-(1H-benzimidazol-2-yl)-N-[[2-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]propan-1-amine (PubChem CID 66538056) has the molecular formula C26H26Cl3N3O2 and a molecular weight of 518.87 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[2-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[2-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66538056 |
| Molecular Formula | C26H26Cl3N3O2 |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[2-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]propan-1-amine |
| SMILES | CCOc1cc(CNCCCc2nc3ccccc3[nH]2)c(Cl)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H26Cl3N3O2/c1-2-33-24-13-18(15-30-11-5-8-26-31-22-6-3-4-7-23(22)32-26)20(28)14-25(24)34-16-17-9-10-19(27)21(29)12-17/h3-4,6-7,9-10,12-14,30H,2,5,8,11,15-16H2,1H3,(H,31,32) |
| InChIKey | NXAQTOHLBDWQDD-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|