C27H30ClN3O2 — CID 66528933
3-(1H-benzimidazol-2-yl)-N-[[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 66528933) has the molecular formula C27H30ClN3O2 and a molecular weight of 464.01 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66528933 |
| Molecular Formula | C27H30ClN3O2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | CCOc1cc(CNCCCc2nc3ccccc3[nH]2)cc(Cl)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C27H30ClN3O2/c1-3-32-25-16-21(15-22(28)27(25)33-18-20-9-6-8-19(2)14-20)17-29-13-7-12-26-30-23-10-4-5-11-24(23)31-26/h4-6,8-11,14-16,29H,3,7,12-13,17-18H2,1-2H3,(H,30,31) |
| InChIKey | HUDQNQOWEJFXPP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|