C24H23Cl2N3O2 — CID 66527265
2-(1H-benzimidazol-2-yl)-N-[[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]ethanamine (PubChem CID 66527265) has the molecular formula C24H23Cl2N3O2 and a molecular weight of 456.37 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N-[[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]ethanamine.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N-[[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 66527265 |
| Molecular Formula | C24H23Cl2N3O2 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N-[[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]ethanamine |
| SMILES | COc1cc(CNCCc2nc3ccccc3[nH]2)cc(Cl)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H23Cl2N3O2/c1-30-22-13-17(12-19(26)24(22)31-15-16-5-4-6-18(25)11-16)14-27-10-9-23-28-20-7-2-3-8-21(20)29-23/h2-8,11-13,27H,9-10,14-15H2,1H3,(H,28,29) |
| InChIKey | VFDLCMBOJCWLBN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|