C24H24ClN3O2 — CID 66526848
2-(1H-benzimidazol-2-yl)-N-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine (PubChem CID 66526848) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 66526848 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]ethanamine |
| SMILES | COc1cc(CNCCc2nc3ccccc3[nH]2)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H24ClN3O2/c1-29-23-14-17(9-10-22(23)30-16-18-5-4-6-19(25)13-18)15-26-12-11-24-27-20-7-2-3-8-21(20)28-24/h2-10,13-14,26H,11-12,15-16H2,1H3,(H,27,28) |
| InChIKey | LZONQRUFKNHZSF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|