C24H24ClN3O — CID 66529032
3-(1H-benzimidazol-2-yl)-N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 66529032) has the molecular formula C24H24ClN3O and a molecular weight of 405.93 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66529032 |
| Molecular Formula | C24H24ClN3O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | Clc1cccc(COc2ccc(CNCCCc3nc4ccccc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C24H24ClN3O/c25-20-6-3-5-19(15-20)17-29-21-12-10-18(11-13-21)16-26-14-4-9-24-27-22-7-1-2-8-23(22)28-24/h1-3,5-8,10-13,15,26H,4,9,14,16-17H2,(H,27,28) |
| InChIKey | QIXKNGZDHUIVGT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|