C23H21Cl2N3O — CID 66526990
2-(1H-benzimidazol-2-yl)-N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]ethanamine (PubChem CID 66526990) has the molecular formula C23H21Cl2N3O and a molecular weight of 426.35 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]ethanamine.
| Compound Name | 2-(1H-benzimidazol-2-yl)-N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 66526990 |
| Molecular Formula | C23H21Cl2N3O |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]ethanamine |
| SMILES | Clc1ccc(COc2ccc(CNCCc3nc4ccccc4[nH]3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C23H21Cl2N3O/c24-18-8-7-17(20(25)13-18)15-29-19-9-5-16(6-10-19)14-26-12-11-23-27-21-3-1-2-4-22(21)28-23/h1-10,13,26H,11-12,14-15H2,(H,27,28) |
| InChIKey | NZFUCCKPMYBMQU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|