C24H22Cl3N3O — CID 66528626
3-(1H-benzimidazol-2-yl)-N-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]propan-1-amine (PubChem CID 66528626) has the molecular formula C24H22Cl3N3O and a molecular weight of 474.82 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66528626 |
| Molecular Formula | C24H22Cl3N3O |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]propan-1-amine |
| SMILES | Clc1ccc(COc2ccc(Cl)cc2CNCCCc2nc3ccccc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C24H22Cl3N3O/c25-18-9-10-23(31-15-16-7-8-19(26)13-20(16)27)17(12-18)14-28-11-3-6-24-29-21-4-1-2-5-22(21)30-24/h1-2,4-5,7-10,12-13,28H,3,6,11,14-15H2,(H,29,30) |
| InChIKey | ZOWVCMIFVQRSKI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|